C7H8N4O — CID 135754544
2,8-dimethyl-1,5-dihydropurin-6-one (PubChem CID 135754544) has the molecular formula C7H8N4O and a molecular weight of 164.17 g/mol. Its IUPAC name is 2,8-dimethyl-1,5-dihydropurin-6-one.
| Compound Name | 2,8-dimethyl-1,5-dihydropurin-6-one |
|---|---|
| PubChem CID | 135754544 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 2,8-dimethyl-1,5-dihydropurin-6-one |
| SMILES | CC1=NC2C(=O)NC(C)=NC2=N1 |
| InChI | InChI=1S/C7H8N4O/c1-3-8-5-6(9-3)10-4(2)11-7(5)12/h5H,1-2H3,(H,8,9,10,11,12) |
| InChIKey | HCGMGSSYNIMYEA-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |