About 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one
2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one (PubChem CID 135754931) has the molecular formula C9H15N5O3
and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one.
Molecular Properties
| Compound Name | 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one |
| PubChem CID | 135754931 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one |
| SMILES | CN1CN(COCCO)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C9H15N5O3/c1-13-4-14(5-17-3-2-15)7-6(13)8(16)12-9(10)11-7/h15H,2-5H2,1H3,(H3,10,11,12,16) |
| InChIKey | LRDJNZYQLUUOAJ-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one?
The IUPAC name of 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one (CID 135754931) is 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one.
What is the SMILES notation for 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one?
The canonical SMILES for 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one is CN1CN(COCCO)c2nc(N)[nH]c(=O)c21.
What is the InChIKey of 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one?
The InChIKey is LRDJNZYQLUUOAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O3/c1-13-4-14(5-17-3-2-15)7-6(13)8(16)12-9(10)11-7/h15H,2-5H2,1H3,(H3,10,11,12,16).
What are the key properties of 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one?
2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one has a molecular weight of 241.25 g/mol, XLogP of -1.47, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one is sourced from PubChem (CID 135754931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).