C9H15N5O3 — CID 135754931
2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one (PubChem CID 135754931) has the molecular formula C9H15N5O3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one.
| Compound Name | 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one |
|---|---|
| PubChem CID | 135754931 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-amino-9-(2-hydroxyethoxymethyl)-7-methyl-1,8-dihydropurin-6-one |
| SMILES | CN1CN(COCCO)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C9H15N5O3/c1-13-4-14(5-17-3-2-15)7-6(13)8(16)12-9(10)11-7/h15H,2-5H2,1H3,(H3,10,11,12,16) |
| InChIKey | LRDJNZYQLUUOAJ-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|