C8H11N5O3S — CID 135449072
2-amino-9-(2-hydroxyethoxymethyl)-8-sulfanylidene-1,7-dihydropurin-6-one (PubChem CID 135449072) has the molecular formula C8H11N5O3S and a molecular weight of 257.27 g/mol. Its IUPAC name is 2-amino-9-(2-hydroxyethoxymethyl)-8-sulfanylidene-1,7-dihydropurin-6-one.
| Compound Name | 2-amino-9-(2-hydroxyethoxymethyl)-8-sulfanylidene-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135449072 |
| Molecular Formula | C8H11N5O3S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 2-amino-9-(2-hydroxyethoxymethyl)-8-sulfanylidene-1,7-dihydropurin-6-one |
| SMILES | Nc1nc2c([nH]c(=S)n2COCCO)c(=O)[nH]1 |
| InChI | InChI=1S/C8H11N5O3S/c9-7-11-5-4(6(15)12-7)10-8(17)13(5)3-16-2-1-14/h14H,1-3H2,(H,10,17)(H3,9,11,12,15) |
| InChIKey | AYHTVEASJNUNIS-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 121.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|