C18H18NNaO8 — CID 135755531
sodium 2-[3,5-dihydroxy-4-[(E)-N-hydroxy-C-[2-(3-hydroxy-4-methoxyphenyl)ethyl]carbonimidoyl]phenoxy]acetate (PubChem CID 135755531) has the molecular formula C18H18NNaO8 and a molecular weight of 399.33 g/mol. Its IUPAC name is sodium 2-[3,5-dihydroxy-4-[(E)-N-hydroxy-C-[2-(3-hydroxy-4-methoxyphenyl)ethyl]carbonimidoyl]phenoxy]acetate.
| Compound Name | sodium 2-[3,5-dihydroxy-4-[(E)-N-hydroxy-C-[2-(3-hydroxy-4-methoxyphenyl)ethyl]carbonimidoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 135755531 |
| Molecular Formula | C18H18NNaO8 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | sodium 2-[3,5-dihydroxy-4-[(E)-N-hydroxy-C-[2-(3-hydroxy-4-methoxyphenyl)ethyl]carbonimidoyl]phenoxy]acetate |
| SMILES | COc1ccc(CC/C(=N\O)c2c(O)cc(OCC(=O)[O-])cc2O)cc1O.[Na+] |
| InChI | InChI=1S/C18H19NO8.Na/c1-26-16-5-3-10(6-13(16)20)2-4-12(19-25)18-14(21)7-11(8-15(18)22)27-9-17(23)24;/h3,5-8,20-22,25H,2,4,9H2,1H3,(H,23,24);/q;+1/p-1/b19-12+; |
| InChIKey | PKSJUKUDROEZDM-NNTHFVATSA-M |
| XLogP | -2.24 |
| TPSA | 151.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|