C23H26N6O4 — CID 135755891
7-(3,4-dimethoxyphenyl)-2-(3-hydroxypropyl)-5-methyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135755891) has the molecular formula C23H26N6O4 and a molecular weight of 450.50 g/mol. Its IUPAC name is 7-(3,4-dimethoxyphenyl)-2-(3-hydroxypropyl)-5-methyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(3,4-dimethoxyphenyl)-2-(3-hydroxypropyl)-5-methyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135755891 |
| Molecular Formula | C23H26N6O4 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 7-(3,4-dimethoxyphenyl)-2-(3-hydroxypropyl)-5-methyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(C2C(C(=O)Nc3ccccn3)=C(C)Nc3nc(CCCO)nn32)cc1OC |
| InChI | InChI=1S/C23H26N6O4/c1-14-20(22(31)26-18-7-4-5-11-24-18)21(15-9-10-16(32-2)17(13-15)33-3)29-23(25-14)27-19(28-29)8-6-12-30/h4-5,7,9-11,13,21,30H,6,8,12H2,1-3H3,(H,24,26,31)(H,25,27,28) |
| InChIKey | ROFGODGWYBMNCU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |