C21H20Cl2N6O2 — CID 135795998
7-(2,4-dichlorophenyl)-2-(3-hydroxypropyl)-5-methyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135795998) has the molecular formula C21H20Cl2N6O2 and a molecular weight of 459.34 g/mol. Its IUPAC name is 7-(2,4-dichlorophenyl)-2-(3-hydroxypropyl)-5-methyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(2,4-dichlorophenyl)-2-(3-hydroxypropyl)-5-methyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135795998 |
| Molecular Formula | C21H20Cl2N6O2 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 7-(2,4-dichlorophenyl)-2-(3-hydroxypropyl)-5-methyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccn2)C(c2ccc(Cl)cc2Cl)n2nc(CCCO)nc2N1 |
| InChI | InChI=1S/C21H20Cl2N6O2/c1-12-18(20(31)26-16-5-2-3-9-24-16)19(14-8-7-13(22)11-15(14)23)29-21(25-12)27-17(28-29)6-4-10-30/h2-3,5,7-9,11,19,30H,4,6,10H2,1H3,(H,24,26,31)(H,25,27,28) |
| InChIKey | OUFHKPNITRILPX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |