C26H31N5O5 — CID 135627187
(7R)-2-(3-hydroxypropyl)-5-methyl-N-(2-methylphenyl)-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135627187) has the molecular formula C26H31N5O5 and a molecular weight of 493.56 g/mol. Its IUPAC name is (7R)-2-(3-hydroxypropyl)-5-methyl-N-(2-methylphenyl)-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-2-(3-hydroxypropyl)-5-methyl-N-(2-methylphenyl)-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135627187 |
| Molecular Formula | C26H31N5O5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | (7R)-2-(3-hydroxypropyl)-5-methyl-N-(2-methylphenyl)-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc([C@@H]2C(C(=O)Nc3ccccc3C)=C(C)Nc3nc(CCCO)nn32)cc(OC)c1OC |
| InChI | InChI=1S/C26H31N5O5/c1-15-9-6-7-10-18(15)28-25(33)22-16(2)27-26-29-21(11-8-12-32)30-31(26)23(22)17-13-19(34-3)24(36-5)20(14-17)35-4/h6-7,9-10,13-14,23,32H,8,11-12H2,1-5H3,(H,28,33)(H,27,29,30)/t23-/m1/s1 |
| InChIKey | RFPJTLHWJSOZOQ-HSZRJFAPSA-N |
| XLogP | 3.46 |
| TPSA | 119.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |