C32H27FN4O7 — CID 135756305
(11S,14S)-N-[(3-fluoro-4-nitrophenyl)methyl]-11-(4-hydroxyphenyl)-9,12-dioxo-2-oxa-10,13-diazatricyclo[14.2.2.13,7]henicosa-1(18),3,5,7(21),16,19-hexaene-14-carboxamide (PubChem CID 135756305) has the molecular formula C32H27FN4O7 and a molecular weight of 598.59 g/mol. Its IUPAC name is (11S,14S)-N-[(3-fluoro-4-nitrophenyl)methyl]-11-(4-hydroxyphenyl)-9,12-dioxo-2-oxa-10,13-diazatricyclo[14.2.2.13,7]henicosa-1(18),3,5,7(21),16,19-hexaene-14-carboxamide.
| Compound Name | (11S,14S)-N-[(3-fluoro-4-nitrophenyl)methyl]-11-(4-hydroxyphenyl)-9,12-dioxo-2-oxa-10,13-diazatricyclo[14.2.2.13,7]henicosa-1(18),3,5,7(21),16,19-hexaene-14-carboxamide |
|---|---|
| PubChem CID | 135756305 |
| Molecular Formula | C32H27FN4O7 |
| Molecular Weight | 598.59 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | (11S,14S)-N-[(3-fluoro-4-nitrophenyl)methyl]-11-(4-hydroxyphenyl)-9,12-dioxo-2-oxa-10,13-diazatricyclo[14.2.2.13,7]henicosa-1(18),3,5,7(21),16,19-hexaene-14-carboxamide |
| SMILES | O=C1Cc2cccc(c2)Oc2ccc(cc2)C[C@@H](C(=O)NCc2ccc([N+](=O)[O-])c(F)c2)NC(=O)[C@H](c2ccc(O)cc2)N1 |
| InChI | InChI=1S/C32H27FN4O7/c33-26-15-21(6-13-28(26)37(42)43)18-34-31(40)27-16-19-4-11-24(12-5-19)44-25-3-1-2-20(14-25)17-29(39)36-30(32(41)35-27)22-7-9-23(38)10-8-22/h1-15,27,30,38H,16-18H2,(H,34,40)(H,35,41)(H,36,39)/t27-,30-/m0/s1 |
| InChIKey | WNMODHTWYADFER-FIBWVYCGSA-N |
| XLogP | 3.99 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|