C20H22N4O7S — CID 135757401
N-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 135757401) has the molecular formula C20H22N4O7S and a molecular weight of 462.48 g/mol. Its IUPAC name is N-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 135757401 |
| Molecular Formula | C20H22N4O7S |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | N-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cccc(S(=O)(=O)N3CCCCC3)c2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C20H22N4O7S/c1-31-18-11-14(10-17(19(18)25)24(27)28)13-21-22-20(26)15-6-5-7-16(12-15)32(29,30)23-8-3-2-4-9-23/h5-7,10-13,25H,2-4,8-9H2,1H3,(H,22,26)/b21-13- |
| InChIKey | OKNHGRRUYXIWIZ-BKUYFWCQSA-N |
| XLogP | 2.25 |
| TPSA | 151.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|