C24H27N2O2+ — CID 135758184
1-[[(2S)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]iminomethyl]naphthalen-2-ol (PubChem CID 135758184) has the molecular formula C24H27N2O2+ and a molecular weight of 375.49 g/mol. Its IUPAC name is 1-[[(2S)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]iminomethyl]naphthalen-2-ol.
| Compound Name | 1-[[(2S)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]iminomethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 135758184 |
| Molecular Formula | C24H27N2O2+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 1-[[(2S)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]iminomethyl]naphthalen-2-ol |
| SMILES | COc1ccccc1[C@@H](C/N=C/c1c(O)ccc2ccccc12)[NH+]1CCCC1 |
| InChI | InChI=1S/C24H26N2O2/c1-28-24-11-5-4-10-20(24)22(26-14-6-7-15-26)17-25-16-21-19-9-3-2-8-18(19)12-13-23(21)27/h2-5,8-13,16,22,27H,6-7,14-15,17H2,1H3/p+1/b25-16+/t22-/m1/s1 |
| InChIKey | RRMBCNXWDSTSDA-NJRDNMGOSA-O |
| XLogP | 3.39 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|