C18H24N2O5 — CID 135759646
8-[(2E)-2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enylidene]hydrazinyl]-8-oxooctanoic acid (PubChem CID 135759646) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 8-[(2E)-2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enylidene]hydrazinyl]-8-oxooctanoic acid.
| Compound Name | 8-[(2E)-2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enylidene]hydrazinyl]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 135759646 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 8-[(2E)-2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enylidene]hydrazinyl]-8-oxooctanoic acid |
| SMILES | COc1cc(/C=C/C=N/NC(=O)CCCCCCC(=O)O)ccc1O |
| InChI | InChI=1S/C18H24N2O5/c1-25-16-13-14(10-11-15(16)21)7-6-12-19-20-17(22)8-4-2-3-5-9-18(23)24/h6-7,10-13,21H,2-5,8-9H2,1H3,(H,20,22)(H,23,24)/b7-6+,19-12+ |
| InChIKey | JWNKANCKNMETLD-OMAKOEHPSA-N |
| XLogP | 2.94 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|