C16H22N2O5 — CID 23836163
7-[(2E)-2-[(2,6-dimethoxyphenyl)methylidene]hydrazinyl]-7-oxoheptanoic acid (PubChem CID 23836163) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is 7-[(2E)-2-[(2,6-dimethoxyphenyl)methylidene]hydrazinyl]-7-oxoheptanoic acid.
| Compound Name | 7-[(2E)-2-[(2,6-dimethoxyphenyl)methylidene]hydrazinyl]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 23836163 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 7-[(2E)-2-[(2,6-dimethoxyphenyl)methylidene]hydrazinyl]-7-oxoheptanoic acid |
| SMILES | COc1cccc(OC)c1/C=N/NC(=O)CCCCCC(=O)O |
| InChI | InChI=1S/C16H22N2O5/c1-22-13-7-6-8-14(23-2)12(13)11-17-18-15(19)9-4-3-5-10-16(20)21/h6-8,11H,3-5,9-10H2,1-2H3,(H,18,19)(H,20,21)/b17-11+ |
| InChIKey | PSSMUMZNDLDXTA-GZTJUZNOSA-N |
| XLogP | 2.19 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|