C23H20N2O4S2 — CID 135760548
N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-2-(4-ethylsulfonylphenyl)acetamide (PubChem CID 135760548) has the molecular formula C23H20N2O4S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-2-(4-ethylsulfonylphenyl)acetamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-2-(4-ethylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 135760548 |
| Molecular Formula | C23H20N2O4S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-2-(4-ethylsulfonylphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(O)c(-c3nc4ccccc4s3)c2)cc1 |
| InChI | InChI=1S/C23H20N2O4S2/c1-2-31(28,29)17-10-7-15(8-11-17)13-22(27)24-16-9-12-20(26)18(14-16)23-25-19-5-3-4-6-21(19)30-23/h3-12,14,26H,2,13H2,1H3,(H,24,27) |
| InChIKey | DLUKQSORYDYMJB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|