C23H16N4O3 — CID 135767018
3-[[(Z)-1-hydroxy-3-oxo-1,3-diphenylprop-1-en-2-yl]diazenyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 135767018) has the molecular formula C23H16N4O3 and a molecular weight of 396.41 g/mol. Its IUPAC name is 3-[[(Z)-1-hydroxy-3-oxo-1,3-diphenylprop-1-en-2-yl]diazenyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-[[(Z)-1-hydroxy-3-oxo-1,3-diphenylprop-1-en-2-yl]diazenyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 135767018 |
| Molecular Formula | C23H16N4O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 3-[[(Z)-1-hydroxy-3-oxo-1,3-diphenylprop-1-en-2-yl]diazenyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=C(C(/N=N/c1cnc2ccccn2c1=O)=C(/O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H16N4O3/c28-21(16-9-3-1-4-10-16)20(22(29)17-11-5-2-6-12-17)26-25-18-15-24-19-13-7-8-14-27(19)23(18)30/h1-15,28H/b21-20-,26-25+ |
| InChIKey | KUYSCNSKYMSUDN-SDEHWINOSA-N |
| XLogP | 4.59 |
| TPSA | 96.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|