C14H12N6O4 — CID 135767021
6-hydroxy-1,3-dimethyl-5-[(4-oxopyrido[1,2-a]pyrimidin-3-yl)diazenyl]pyrimidine-2,4-dione (PubChem CID 135767021) has the molecular formula C14H12N6O4 and a molecular weight of 328.29 g/mol. Its IUPAC name is 6-hydroxy-1,3-dimethyl-5-[(4-oxopyrido[1,2-a]pyrimidin-3-yl)diazenyl]pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1,3-dimethyl-5-[(4-oxopyrido[1,2-a]pyrimidin-3-yl)diazenyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135767021 |
| Molecular Formula | C14H12N6O4 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 6-hydroxy-1,3-dimethyl-5-[(4-oxopyrido[1,2-a]pyrimidin-3-yl)diazenyl]pyrimidine-2,4-dione |
| SMILES | Cn1c(O)c(/N=N/c2cnc3ccccn3c2=O)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H12N6O4/c1-18-12(22)10(13(23)19(2)14(18)24)17-16-8-7-15-9-5-3-4-6-20(9)11(8)21/h3-7,22H,1-2H3/b17-16+ |
| InChIKey | XSAMYZDHJDIDAK-WUKNDPDISA-N |
| XLogP | 0.21 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|