C19H15CuN5O5+2 — CID 158751448
copper 4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-2-methylbenzo[e]isoindole-1,3-dione (PubChem CID 158751448) has the molecular formula C19H15CuN5O5+2 and a molecular weight of 456.91 g/mol. Its IUPAC name is copper 4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-2-methylbenzo[e]isoindole-1,3-dione.
| Compound Name | copper 4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-2-methylbenzo[e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 158751448 |
| Molecular Formula | C19H15CuN5O5+2 |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | copper 4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-2-methylbenzo[e]isoindole-1,3-dione |
| SMILES | CN1C(=O)c2c(/N=N/c3c(O)n(C)c(=O)n(C)c3=O)cc3ccccc3c2C1=O.[Cu+2] |
| InChI | InChI=1S/C19H15N5O5.Cu/c1-22-15(25)12-10-7-5-4-6-9(10)8-11(13(12)16(22)26)20-21-14-17(27)23(2)19(29)24(3)18(14)28;/h4-8,27H,1-3H3;/q;+2/b21-20+; |
| InChIKey | INNLMRQPLHFWJU-ANVLNOONSA-N |
| XLogP | 1.58 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|