C18H17Cl2N5NiO5+2 — CID 158887382
5,7-dichloro-4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-2-(2-methylpropyl)isoindole-1,3-dione;nickel(2+) (PubChem CID 158887382) has the molecular formula C18H17Cl2N5NiO5+2 and a molecular weight of 512.96 g/mol. Its IUPAC name is 5,7-dichloro-4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-2-(2-methylpropyl)isoindole-1,3-dione;nickel(2+).
| Compound Name | 5,7-dichloro-4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-2-(2-methylpropyl)isoindole-1,3-dione;nickel(2+) |
|---|---|
| PubChem CID | 158887382 |
| Molecular Formula | C18H17Cl2N5NiO5+2 |
| Molecular Weight | 512.96 g/mol |
| Exact Mass | 510.99 |
| IUPAC Name | 5,7-dichloro-4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-2-(2-methylpropyl)isoindole-1,3-dione;nickel(2+) |
| SMILES | CC(C)CN1C(=O)c2c(Cl)cc(Cl)c(/N=N/c3c(O)n(C)c(=O)n(C)c3=O)c2C1=O.[Ni+2] |
| InChI | InChI=1S/C18H17Cl2N5O5.Ni/c1-7(2)6-25-14(26)10-8(19)5-9(20)12(11(10)15(25)27)21-22-13-16(28)23(3)18(30)24(4)17(13)29;/h5,7,28H,6H2,1-4H3;/q;+2/b22-21+; |
| InChIKey | JDUMSTFUNUQGOE-QUABFQRHSA-N |
| XLogP | 2.76 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.96 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|