C20H16F3N5NiO4+2 — CID 158113360
2-hydroxy-1-methyl-5-[[2-(2-methylpropyl)-1,3-dioxoisoindol-4-yl]diazenyl]-6-oxo-4-(trifluoromethyl)pyridine-3-carbonitrile;nickel(2+) (PubChem CID 158113360) has the molecular formula C20H16F3N5NiO4+2 and a molecular weight of 506.07 g/mol. Its IUPAC name is 2-hydroxy-1-methyl-5-[[2-(2-methylpropyl)-1,3-dioxoisoindol-4-yl]diazenyl]-6-oxo-4-(trifluoromethyl)pyridine-3-carbonitrile;nickel(2+).
| Compound Name | 2-hydroxy-1-methyl-5-[[2-(2-methylpropyl)-1,3-dioxoisoindol-4-yl]diazenyl]-6-oxo-4-(trifluoromethyl)pyridine-3-carbonitrile;nickel(2+) |
|---|---|
| PubChem CID | 158113360 |
| Molecular Formula | C20H16F3N5NiO4+2 |
| Molecular Weight | 506.07 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | 2-hydroxy-1-methyl-5-[[2-(2-methylpropyl)-1,3-dioxoisoindol-4-yl]diazenyl]-6-oxo-4-(trifluoromethyl)pyridine-3-carbonitrile;nickel(2+) |
| SMILES | CC(C)CN1C(=O)c2cccc(/N=N/c3c(C(F)(F)F)c(C#N)c(O)n(C)c3=O)c2C1=O.[Ni+2] |
| InChI | InChI=1S/C20H16F3N5O4.Ni/c1-9(2)8-28-17(30)10-5-4-6-12(13(10)18(28)31)25-26-15-14(20(21,22)23)11(7-24)16(29)27(3)19(15)32;/h4-6,9,29H,8H2,1-3H3;/q;+2/b26-25+; |
| InChIKey | JDYHZVGBTNMULB-BTKVJIOYSA-N |
| XLogP | 3.65 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.07 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|