C19H21N5NiO5+2 — CID 159066696
4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-2-pentan-3-ylisoindole-1,3-dione;nickel(2+) (PubChem CID 159066696) has the molecular formula C19H21N5NiO5+2 and a molecular weight of 458.10 g/mol. Its IUPAC name is 4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-2-pentan-3-ylisoindole-1,3-dione;nickel(2+).
| Compound Name | 4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-2-pentan-3-ylisoindole-1,3-dione;nickel(2+) |
|---|---|
| PubChem CID | 159066696 |
| Molecular Formula | C19H21N5NiO5+2 |
| Molecular Weight | 458.10 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-2-pentan-3-ylisoindole-1,3-dione;nickel(2+) |
| SMILES | CCC(CC)N1C(=O)c2cccc(/N=N/c3c(O)n(C)c(=O)n(C)c3=O)c2C1=O.[Ni+2] |
| InChI | InChI=1S/C19H21N5O5.Ni/c1-5-10(6-2)24-15(25)11-8-7-9-12(13(11)16(24)26)20-21-14-17(27)22(3)19(29)23(4)18(14)28;/h7-10,27H,5-6H2,1-4H3;/q;+2/b21-20+; |
| InChIKey | JZDJWTWDZUVNAV-ANVLNOONSA-N |
| XLogP | 1.99 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.10 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|