C20H24N4O4 — CID 91612512
tert-butyl 2-cyano-2-[(1,3-dioxo-2-pentan-3-ylisoindol-4-yl)diazenyl]acetate (PubChem CID 91612512) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is tert-butyl 2-cyano-2-[(1,3-dioxo-2-pentan-3-ylisoindol-4-yl)diazenyl]acetate.
| Compound Name | tert-butyl 2-cyano-2-[(1,3-dioxo-2-pentan-3-ylisoindol-4-yl)diazenyl]acetate |
|---|---|
| PubChem CID | 91612512 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | tert-butyl 2-cyano-2-[(1,3-dioxo-2-pentan-3-ylisoindol-4-yl)diazenyl]acetate |
| SMILES | CCC(CC)N1C(=O)c2cccc(/N=N/C(C#N)C(=O)OC(C)(C)C)c2C1=O |
| InChI | InChI=1S/C20H24N4O4/c1-6-12(7-2)24-17(25)13-9-8-10-14(16(13)18(24)26)22-23-15(11-21)19(27)28-20(3,4)5/h8-10,12,15H,6-7H2,1-5H3/b23-22+ |
| InChIKey | YQDFCVAQRSNVGO-GHVJWSGMSA-N |
| XLogP | 3.79 |
| TPSA | 112.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|