C21H24N3O5- — CID 59482186
2-[[2-(1-methoxybutan-2-yl)-1,3-dioxoisoindol-4-yl]diazenyl]-5,5-dimethyl-3-oxocyclohexen-1-olate (PubChem CID 59482186) has the molecular formula C21H24N3O5- and a molecular weight of 398.44 g/mol. Its IUPAC name is 2-[[2-(1-methoxybutan-2-yl)-1,3-dioxoisoindol-4-yl]diazenyl]-5,5-dimethyl-3-oxocyclohexen-1-olate.
| Compound Name | 2-[[2-(1-methoxybutan-2-yl)-1,3-dioxoisoindol-4-yl]diazenyl]-5,5-dimethyl-3-oxocyclohexen-1-olate |
|---|---|
| PubChem CID | 59482186 |
| Molecular Formula | C21H24N3O5- |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-[[2-(1-methoxybutan-2-yl)-1,3-dioxoisoindol-4-yl]diazenyl]-5,5-dimethyl-3-oxocyclohexen-1-olate |
| SMILES | CCC(COC)N1C(=O)c2cccc(/N=N/C3=C([O-])CC(C)(C)CC3=O)c2C1=O |
| InChI | InChI=1S/C21H25N3O5/c1-5-12(11-29-4)24-19(27)13-7-6-8-14(17(13)20(24)28)22-23-18-15(25)9-21(2,3)10-16(18)26/h6-8,12,25H,5,9-11H2,1-4H3/p-1/b23-22+ |
| InChIKey | FMAHURYXFTWRCV-GHVJWSGMSA-M |
| XLogP | 2.75 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|