C22H25N3O6 — CID 143507975
4-[(2-methoxy-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-3-yl)diazenyl]-2-(2-methylpropyl)isoindole-1,3-dione (PubChem CID 143507975) has the molecular formula C22H25N3O6 and a molecular weight of 427.46 g/mol. Its IUPAC name is 4-[(2-methoxy-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-3-yl)diazenyl]-2-(2-methylpropyl)isoindole-1,3-dione.
| Compound Name | 4-[(2-methoxy-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-3-yl)diazenyl]-2-(2-methylpropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 143507975 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 4-[(2-methoxy-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-3-yl)diazenyl]-2-(2-methylpropyl)isoindole-1,3-dione |
| SMILES | COC1=C(/N=N/c2cccc3c2C(=O)N(CC(C)C)C3=O)C(=O)OC2(CCCCC2)O1 |
| InChI | InChI=1S/C22H25N3O6/c1-13(2)12-25-18(26)14-8-7-9-15(16(14)19(25)27)23-24-17-20(28)30-22(31-21(17)29-3)10-5-4-6-11-22/h7-9,13H,4-6,10-12H2,1-3H3/b24-23+ |
| InChIKey | OQXMDIDIWKOBTA-WCWDXBQESA-N |
| XLogP | 4.07 |
| TPSA | 106.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|