C25H27N3O4 — CID 143507778
4-[(3-methoxy-5-oxo-4-tricyclo[5.2.2.02,6]undeca-3,8-dienyl)diazenyl]-2-pentan-3-ylisoindole-1,3-dione (PubChem CID 143507778) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 4-[(3-methoxy-5-oxo-4-tricyclo[5.2.2.02,6]undeca-3,8-dienyl)diazenyl]-2-pentan-3-ylisoindole-1,3-dione.
| Compound Name | 4-[(3-methoxy-5-oxo-4-tricyclo[5.2.2.02,6]undeca-3,8-dienyl)diazenyl]-2-pentan-3-ylisoindole-1,3-dione |
|---|---|
| PubChem CID | 143507778 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 4-[(3-methoxy-5-oxo-4-tricyclo[5.2.2.02,6]undeca-3,8-dienyl)diazenyl]-2-pentan-3-ylisoindole-1,3-dione |
| SMILES | CCC(CC)N1C(=O)c2cccc(/N=N/C3=C(OC)C4C5C=CC(CC5)C4C3=O)c2C1=O |
| InChI | InChI=1S/C25H27N3O4/c1-4-15(5-2)28-24(30)16-7-6-8-17(20(16)25(28)31)26-27-21-22(29)18-13-9-11-14(12-10-13)19(18)23(21)32-3/h6-9,11,13-15,18-19H,4-5,10,12H2,1-3H3/b27-26+ |
| InChIKey | OEBMVCPGTIFLMQ-CYYJNZCTSA-N |
| XLogP | 4.82 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|