C28H25N5O5 — CID 143507895
2-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]-4-[(4-methoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]isoindole-1,3-dione (PubChem CID 143507895) has the molecular formula C28H25N5O5 and a molecular weight of 511.54 g/mol. Its IUPAC name is 2-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]-4-[(4-methoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]isoindole-1,3-dione.
| Compound Name | 2-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]-4-[(4-methoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 143507895 |
| Molecular Formula | C28H25N5O5 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 2-[cyclohexa-1,5-dien-1-yl(phenyl)methyl]-4-[(4-methoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]isoindole-1,3-dione |
| SMILES | COc1c(/N=N/c2cccc3c2C(=O)N(C(C2=CCCC=C2)c2ccccc2)C3=O)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C28H25N5O5/c1-31-26(36)22(27(38-3)32(2)28(31)37)30-29-20-16-10-15-19-21(20)25(35)33(24(19)34)23(17-11-6-4-7-12-17)18-13-8-5-9-14-18/h4,6-8,10-16,23H,5,9H2,1-3H3/b30-29+ |
| InChIKey | ILDZSLQOQBSKJN-QVIHXGFCSA-N |
| XLogP | 4.12 |
| TPSA | 115.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|