C21H17N5O7Pd+2 — CID 158125702
4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-2-methoxy-5-phenoxyisoindole-1,3-dione;palladium(2+) (PubChem CID 158125702) has the molecular formula C21H17N5O7Pd+2 and a molecular weight of 557.82 g/mol. Its IUPAC name is 4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-2-methoxy-5-phenoxyisoindole-1,3-dione;palladium(2+).
| Compound Name | 4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-2-methoxy-5-phenoxyisoindole-1,3-dione;palladium(2+) |
|---|---|
| PubChem CID | 158125702 |
| Molecular Formula | C21H17N5O7Pd+2 |
| Molecular Weight | 557.82 g/mol |
| Exact Mass | 557.02 |
| IUPAC Name | 4-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-2-methoxy-5-phenoxyisoindole-1,3-dione;palladium(2+) |
| SMILES | CON1C(=O)c2ccc(Oc3ccccc3)c(/N=N/c3c(O)n(C)c(=O)n(C)c3=O)c2C1=O.[Pd+2] |
| InChI | InChI=1S/C21H17N5O7.Pd/c1-24-19(29)16(20(30)25(2)21(24)31)23-22-15-13(33-11-7-5-4-6-8-11)10-9-12-14(15)18(28)26(32-3)17(12)27;/h4-10,29H,1-3H3;/q;+2/b23-22+; |
| InChIKey | FSDKEANSOFGNOZ-PGCQSHBKSA-N |
| XLogP | 2.15 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.82 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|