C21H16N2O2 — CID 135514875
3-hydroxy-1,3-diphenyl-2-phenyldiazenylprop-2-en-1-one (PubChem CID 135514875) has the molecular formula C21H16N2O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-hydroxy-1,3-diphenyl-2-phenyldiazenylprop-2-en-1-one.
| Compound Name | 3-hydroxy-1,3-diphenyl-2-phenyldiazenylprop-2-en-1-one |
|---|---|
| PubChem CID | 135514875 |
| Molecular Formula | C21H16N2O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 3-hydroxy-1,3-diphenyl-2-phenyldiazenylprop-2-en-1-one |
| SMILES | O=C(C(/N=N/c1ccccc1)=C(O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16N2O2/c24-20(16-10-4-1-5-11-16)19(21(25)17-12-6-2-7-13-17)23-22-18-14-8-3-9-15-18/h1-15,24H/b20-19?,23-22+ |
| InChIKey | PQMKQGAVCMQGRT-YRFCHYIFSA-N |
| XLogP | 5.58 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|