C23H26N5O2+ — CID 135774690
[(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl]-[2-(2,3-dimethylanilino)-2-oxoethyl]-methylazanium (PubChem CID 135774690) has the molecular formula C23H26N5O2+ and a molecular weight of 404.49 g/mol. Its IUPAC name is [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl]-[2-(2,3-dimethylanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl]-[2-(2,3-dimethylanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 135774690 |
| Molecular Formula | C23H26N5O2+ |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl]-[2-(2,3-dimethylanilino)-2-oxoethyl]-methylazanium |
| SMILES | Cc1cccc(NC(=O)C[NH+](C)C/C(O)=C(\C#N)c2nc3ccccc3n2C)c1C |
| InChI | InChI=1S/C23H25N5O2/c1-15-8-7-10-18(16(15)2)25-22(30)14-27(3)13-21(29)17(12-24)23-26-19-9-5-6-11-20(19)28(23)4/h5-11,29H,13-14H2,1-4H3,(H,25,30)/p+1/b21-17- |
| InChIKey | UMNDUFRTVXLVFK-FXBPSFAMSA-O |
| XLogP | 2.14 |
| TPSA | 95.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|