C18H13ClN4OS — CID 135778125
(2Z)-2-[(E)-[2-(4-chlorophenyl)-1H-indol-3-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135778125) has the molecular formula C18H13ClN4OS and a molecular weight of 368.85 g/mol. Its IUPAC name is (2Z)-2-[(E)-[2-(4-chlorophenyl)-1H-indol-3-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-[(E)-[2-(4-chlorophenyl)-1H-indol-3-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135778125 |
| Molecular Formula | C18H13ClN4OS |
| Molecular Weight | 368.85 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | (2Z)-2-[(E)-[2-(4-chlorophenyl)-1H-indol-3-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N\N=C\c2c(-c3ccc(Cl)cc3)[nH]c3ccccc23)N1 |
| InChI | InChI=1S/C18H13ClN4OS/c19-12-7-5-11(6-8-12)17-14(13-3-1-2-4-15(13)21-17)9-20-23-18-22-16(24)10-25-18/h1-9,21H,10H2,(H,22,23,24)/b20-9+ |
| InChIKey | VCBOTAMRPLWXSS-AWQFTUOYSA-N |
| XLogP | 4.04 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.85 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|