C26H22N4OS — CID 135711976
(2E)-5-[(4-methylphenyl)methyl]-2-[(E)-(2-phenyl-1H-indol-3-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135711976) has the molecular formula C26H22N4OS and a molecular weight of 438.56 g/mol. Its IUPAC name is (2E)-5-[(4-methylphenyl)methyl]-2-[(E)-(2-phenyl-1H-indol-3-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[(4-methylphenyl)methyl]-2-[(E)-(2-phenyl-1H-indol-3-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135711976 |
| Molecular Formula | C26H22N4OS |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (2E)-5-[(4-methylphenyl)methyl]-2-[(E)-(2-phenyl-1H-indol-3-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(CC2S/C(=N/N=C/c3c(-c4ccccc4)[nH]c4ccccc34)NC2=O)cc1 |
| InChI | InChI=1S/C26H22N4OS/c1-17-11-13-18(14-12-17)15-23-25(31)29-26(32-23)30-27-16-21-20-9-5-6-10-22(20)28-24(21)19-7-3-2-4-8-19/h2-14,16,23,28H,15H2,1H3,(H,29,30,31)/b27-16+ |
| InChIKey | MYKYIBDUZRPUPA-JVWAILMASA-N |
| XLogP | 5.31 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|