C26H19BrN4O2S — CID 135851288
(2Z)-5-[2-(4-bromophenyl)-2-oxoethyl]-2-[(E)-(2-phenyl-1H-indol-3-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135851288) has the molecular formula C26H19BrN4O2S and a molecular weight of 531.44 g/mol. Its IUPAC name is (2Z)-5-[2-(4-bromophenyl)-2-oxoethyl]-2-[(E)-(2-phenyl-1H-indol-3-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-5-[2-(4-bromophenyl)-2-oxoethyl]-2-[(E)-(2-phenyl-1H-indol-3-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135851288 |
| Molecular Formula | C26H19BrN4O2S |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 530.04 |
| IUPAC Name | (2Z)-5-[2-(4-bromophenyl)-2-oxoethyl]-2-[(E)-(2-phenyl-1H-indol-3-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C(CC1S/C(=N\N=C\c2c(-c3ccccc3)[nH]c3ccccc23)NC1=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H19BrN4O2S/c27-18-12-10-16(11-13-18)22(32)14-23-25(33)30-26(34-23)31-28-15-20-19-8-4-5-9-21(19)29-24(20)17-6-2-1-3-7-17/h1-13,15,23,29H,14H2,(H,30,31,33)/b28-15+ |
| InChIKey | WFQBELCEWPZURM-RWPZCVJISA-N |
| XLogP | 5.79 |
| TPSA | 86.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|