C28H24N4O2S — CID 135734155
(2E)-5-[2-(3,4-dimethylphenyl)-2-oxoethyl]-2-[(E)-(2-phenyl-1H-indol-3-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135734155) has the molecular formula C28H24N4O2S and a molecular weight of 480.59 g/mol. Its IUPAC name is (2E)-5-[2-(3,4-dimethylphenyl)-2-oxoethyl]-2-[(E)-(2-phenyl-1H-indol-3-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[2-(3,4-dimethylphenyl)-2-oxoethyl]-2-[(E)-(2-phenyl-1H-indol-3-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135734155 |
| Molecular Formula | C28H24N4O2S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | (2E)-5-[2-(3,4-dimethylphenyl)-2-oxoethyl]-2-[(E)-(2-phenyl-1H-indol-3-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(C(=O)CC2S/C(=N/N=C/c3c(-c4ccccc4)[nH]c4ccccc34)NC2=O)cc1C |
| InChI | InChI=1S/C28H24N4O2S/c1-17-12-13-20(14-18(17)2)24(33)15-25-27(34)31-28(35-25)32-29-16-22-21-10-6-7-11-23(21)30-26(22)19-8-4-3-5-9-19/h3-14,16,25,30H,15H2,1-2H3,(H,31,32,34)/b29-16+ |
| InChIKey | KFTZIJOPFFSCME-MUFRIFMGSA-N |
| XLogP | 5.65 |
| TPSA | 86.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|