C20H17N5O3S — CID 155560979
(2Z)-5-ethyl-2-[(E)-[2-(4-nitrophenyl)-1H-indol-3-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 155560979) has the molecular formula C20H17N5O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is (2Z)-5-ethyl-2-[(E)-[2-(4-nitrophenyl)-1H-indol-3-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-5-ethyl-2-[(E)-[2-(4-nitrophenyl)-1H-indol-3-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 155560979 |
| Molecular Formula | C20H17N5O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | (2Z)-5-ethyl-2-[(E)-[2-(4-nitrophenyl)-1H-indol-3-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CCC1S/C(=N\N=C\c2c(-c3ccc([N+](=O)[O-])cc3)[nH]c3ccccc23)NC1=O |
| InChI | InChI=1S/C20H17N5O3S/c1-2-17-19(26)23-20(29-17)24-21-11-15-14-5-3-4-6-16(14)22-18(15)12-7-9-13(10-8-12)25(27)28/h3-11,17,22H,2H2,1H3,(H,23,24,26)/b21-11+ |
| InChIKey | KLEUBAPJNMSHHT-SRZZPIQSSA-N |
| XLogP | 4.07 |
| TPSA | 112.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|