C30H34N4O8 — CID 135781864
ethyl N-[(Z)-2-[[4-[2-[4-[[(E)-2-(ethoxycarbonylcarbamoyl)-3-hydroxybut-2-enylidene]amino]phenyl]ethyl]phenyl]iminomethyl]-3-hydroxybut-2-enoyl]carbamate (PubChem CID 135781864) has the molecular formula C30H34N4O8 and a molecular weight of 578.62 g/mol. Its IUPAC name is ethyl N-[(Z)-2-[[4-[2-[4-[[(E)-2-(ethoxycarbonylcarbamoyl)-3-hydroxybut-2-enylidene]amino]phenyl]ethyl]phenyl]iminomethyl]-3-hydroxybut-2-enoyl]carbamate.
| Compound Name | ethyl N-[(Z)-2-[[4-[2-[4-[[(E)-2-(ethoxycarbonylcarbamoyl)-3-hydroxybut-2-enylidene]amino]phenyl]ethyl]phenyl]iminomethyl]-3-hydroxybut-2-enoyl]carbamate |
|---|---|
| PubChem CID | 135781864 |
| Molecular Formula | C30H34N4O8 |
| Molecular Weight | 578.62 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | ethyl N-[(Z)-2-[[4-[2-[4-[[(E)-2-(ethoxycarbonylcarbamoyl)-3-hydroxybut-2-enylidene]amino]phenyl]ethyl]phenyl]iminomethyl]-3-hydroxybut-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(/C=N/c1ccc(CCc2ccc(/N=C/C(C(=O)NC(=O)OCC)=C(/C)O)cc2)cc1)=C(/C)O |
| InChI | InChI=1S/C30H34N4O8/c1-5-41-29(39)33-27(37)25(19(3)35)17-31-23-13-9-21(10-14-23)7-8-22-11-15-24(16-12-22)32-18-26(20(4)36)28(38)34-30(40)42-6-2/h9-18,35-36H,5-8H2,1-4H3,(H,33,37,39)(H,34,38,40)/b25-19-,26-20+,31-17+,32-18+ |
| InChIKey | WJBKOXXIXANSFA-CAAGXKPYSA-N |
| XLogP | 5.09 |
| TPSA | 175.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|