C21H20N2O4 — CID 171984271
ethyl N-[(Z)-2-(9H-fluoren-2-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate (PubChem CID 171984271) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is ethyl N-[(Z)-2-(9H-fluoren-2-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate.
| Compound Name | ethyl N-[(Z)-2-(9H-fluoren-2-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate |
|---|---|
| PubChem CID | 171984271 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | ethyl N-[(Z)-2-(9H-fluoren-2-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(/C=N/c1ccc2c(c1)Cc1ccccc1-2)=C(/C)O |
| InChI | InChI=1S/C21H20N2O4/c1-3-27-21(26)23-20(25)19(13(2)24)12-22-16-8-9-18-15(11-16)10-14-6-4-5-7-17(14)18/h4-9,11-12,24H,3,10H2,1-2H3,(H,23,25,26)/b19-13-,22-12+ |
| InChIKey | VMHHESKWWURCGD-ULVKKSIPSA-N |
| XLogP | 4.06 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|