C13H13N3O4 — CID 135782124
N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 135782124) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 135782124 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc(C)on2)ccc1O |
| InChI | InChI=1S/C13H13N3O4/c1-8-5-10(16-20-8)13(18)15-14-7-9-3-4-11(17)12(6-9)19-2/h3-7,17H,1-2H3,(H,15,18)/b14-7- |
| InChIKey | UBTPYEKPVBQZFM-AUWJEWJLSA-N |
| XLogP | 1.46 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|