C11H20Cl2N4 — CID 135784100
2,6-dichloro-N-octyl-1,3-dihydrotriazin-4-imine (PubChem CID 135784100) has the molecular formula C11H20Cl2N4 and a molecular weight of 279.21 g/mol. Its IUPAC name is 2,6-dichloro-N-octyl-1,3-dihydrotriazin-4-imine.
| Compound Name | 2,6-dichloro-N-octyl-1,3-dihydrotriazin-4-imine |
|---|---|
| PubChem CID | 135784100 |
| Molecular Formula | C11H20Cl2N4 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2,6-dichloro-N-octyl-1,3-dihydrotriazin-4-imine |
| SMILES | CCCCCCCC/N=C1\C=C(Cl)NN(Cl)N1 |
| InChI | InChI=1S/C11H20Cl2N4/c1-2-3-4-5-6-7-8-14-11-9-10(12)15-17(13)16-11/h9,15H,2-8H2,1H3,(H,14,16) |
| InChIKey | WRDPNEOBRJCMRZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|