C22H17NO5 — CID 135787058
3-hydroxy-2-(3-hydroxy-6-propan-2-ylquinolin-2-yl)-1-oxoindene-5-carboxylic acid (PubChem CID 135787058) has the molecular formula C22H17NO5 and a molecular weight of 375.38 g/mol. Its IUPAC name is 3-hydroxy-2-(3-hydroxy-6-propan-2-ylquinolin-2-yl)-1-oxoindene-5-carboxylic acid.
| Compound Name | 3-hydroxy-2-(3-hydroxy-6-propan-2-ylquinolin-2-yl)-1-oxoindene-5-carboxylic acid |
|---|---|
| PubChem CID | 135787058 |
| Molecular Formula | C22H17NO5 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 3-hydroxy-2-(3-hydroxy-6-propan-2-ylquinolin-2-yl)-1-oxoindene-5-carboxylic acid |
| SMILES | CC(C)c1ccc2nc(C3=C(O)c4cc(C(=O)O)ccc4C3=O)c(O)cc2c1 |
| InChI | InChI=1S/C22H17NO5/c1-10(2)11-4-6-16-13(7-11)9-17(24)19(23-16)18-20(25)14-5-3-12(22(27)28)8-15(14)21(18)26/h3-10,24,26H,1-2H3,(H,27,28) |
| InChIKey | FIHFBFCNNMETSZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'} |
|---|