C21H17NO3 — CID 20695798
2-(3-hydroxy-6-propan-2-ylquinolin-2-yl)indene-1,3-dione (PubChem CID 20695798) has the molecular formula C21H17NO3 and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-(3-hydroxy-6-propan-2-ylquinolin-2-yl)indene-1,3-dione.
| Compound Name | 2-(3-hydroxy-6-propan-2-ylquinolin-2-yl)indene-1,3-dione |
|---|---|
| PubChem CID | 20695798 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-(3-hydroxy-6-propan-2-ylquinolin-2-yl)indene-1,3-dione |
| SMILES | CC(C)c1ccc2nc(C3C(=O)c4ccccc4C3=O)c(O)cc2c1 |
| InChI | InChI=1S/C21H17NO3/c1-11(2)12-7-8-16-13(9-12)10-17(23)19(22-16)18-20(24)14-5-3-4-6-15(14)21(18)25/h3-11,18,23H,1-2H3 |
| InChIKey | WZLRAOQLCCIYNR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|