C30H34N2O4 — CID 130207081
(2R)-2-(3-hydroxy-6-propan-2-ylquinolin-2-yl)-N,N-bis(2-methylpropyl)-1,3-dioxoindene-5-carboxamide (PubChem CID 130207081) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is (2R)-2-(3-hydroxy-6-propan-2-ylquinolin-2-yl)-N,N-bis(2-methylpropyl)-1,3-dioxoindene-5-carboxamide.
| Compound Name | (2R)-2-(3-hydroxy-6-propan-2-ylquinolin-2-yl)-N,N-bis(2-methylpropyl)-1,3-dioxoindene-5-carboxamide |
|---|---|
| PubChem CID | 130207081 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | (2R)-2-(3-hydroxy-6-propan-2-ylquinolin-2-yl)-N,N-bis(2-methylpropyl)-1,3-dioxoindene-5-carboxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)c1ccc2c(c1)C(=O)[C@H](c1nc3ccc(C(C)C)cc3cc1O)C2=O |
| InChI | InChI=1S/C30H34N2O4/c1-16(2)14-32(15-17(3)4)30(36)20-7-9-22-23(12-20)29(35)26(28(22)34)27-25(33)13-21-11-19(18(5)6)8-10-24(21)31-27/h7-13,16-18,26,33H,14-15H2,1-6H3/t26-/m1/s1 |
| InChIKey | MNZSENHKJXDYDK-AREMUKBSSA-N |
| XLogP | 5.98 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|