C25H19NO7 — CID 162207629
2-(2-methylprop-2-enoyloxy)ethyl 2-(3-hydroxyquinolin-2-yl)-1,3-dioxoindene-5-carboxylate (PubChem CID 162207629) has the molecular formula C25H19NO7 and a molecular weight of 445.43 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 2-(3-hydroxyquinolin-2-yl)-1,3-dioxoindene-5-carboxylate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-(3-hydroxyquinolin-2-yl)-1,3-dioxoindene-5-carboxylate |
|---|---|
| PubChem CID | 162207629 |
| Molecular Formula | C25H19NO7 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-(3-hydroxyquinolin-2-yl)-1,3-dioxoindene-5-carboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1ccc2c(c1)C(=O)C(c1nc3ccccc3cc1O)C2=O |
| InChI | InChI=1S/C25H19NO7/c1-13(2)24(30)32-9-10-33-25(31)15-7-8-16-17(11-15)23(29)20(22(16)28)21-19(27)12-14-5-3-4-6-18(14)26-21/h3-8,11-12,20,27H,1,9-10H2,2H3 |
| InChIKey | OQOWICFUPVTJGW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|