C18H24N4O3S — CID 135788179
methyl 6-[(1-ethyl-2-hydroxyindol-3-yl)iminocarbamothioylamino]hexanoate (PubChem CID 135788179) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is methyl 6-[(1-ethyl-2-hydroxyindol-3-yl)iminocarbamothioylamino]hexanoate.
| Compound Name | methyl 6-[(1-ethyl-2-hydroxyindol-3-yl)iminocarbamothioylamino]hexanoate |
|---|---|
| PubChem CID | 135788179 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | methyl 6-[(1-ethyl-2-hydroxyindol-3-yl)iminocarbamothioylamino]hexanoate |
| SMILES | CCn1c(O)c(/N=N/C(=S)NCCCCCC(=O)OC)c2ccccc21 |
| InChI | InChI=1S/C18H24N4O3S/c1-3-22-14-10-7-6-9-13(14)16(17(22)24)20-21-18(26)19-12-8-4-5-11-15(23)25-2/h6-7,9-10,24H,3-5,8,11-12H2,1-2H3,(H,19,26)/b21-20+ |
| InChIKey | UDLXSHVHMKRLGD-QZQOTICOSA-N |
| XLogP | 4.06 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|