C33H36FN5O2S — CID 135792704
N-(2,4-dimethylphenyl)-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-7-(4-pentoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135792704) has the molecular formula C33H36FN5O2S and a molecular weight of 585.75 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-7-(4-pentoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-7-(4-pentoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135792704 |
| Molecular Formula | C33H36FN5O2S |
| Molecular Weight | 585.75 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-7-(4-pentoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCCOc1ccc(C2C(C(=O)Nc3ccc(C)cc3C)=C(C)Nc3nc(SCc4ccccc4F)nn32)cc1 |
| InChI | InChI=1S/C33H36FN5O2S/c1-5-6-9-18-41-26-15-13-24(14-16-26)30-29(31(40)36-28-17-12-21(2)19-22(28)3)23(4)35-32-37-33(38-39(30)32)42-20-25-10-7-8-11-27(25)34/h7-8,10-17,19,30H,5-6,9,18,20H2,1-4H3,(H,36,40)(H,35,37,38) |
| InChIKey | YDYPOVHSLHUNCN-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.75 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|