C19H18N4S — CID 135794199
N-[(Z)-1H-indol-3-ylmethylideneamino]-3,4-dihydro-2H-quinoline-1-carbothioamide (PubChem CID 135794199) has the molecular formula C19H18N4S and a molecular weight of 334.45 g/mol. Its IUPAC name is N-[(Z)-1H-indol-3-ylmethylideneamino]-3,4-dihydro-2H-quinoline-1-carbothioamide.
| Compound Name | N-[(Z)-1H-indol-3-ylmethylideneamino]-3,4-dihydro-2H-quinoline-1-carbothioamide |
|---|---|
| PubChem CID | 135794199 |
| Molecular Formula | C19H18N4S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-[(Z)-1H-indol-3-ylmethylideneamino]-3,4-dihydro-2H-quinoline-1-carbothioamide |
| SMILES | S=C(N/N=C\c1c[nH]c2ccccc12)N1CCCc2ccccc21 |
| InChI | InChI=1S/C19H18N4S/c24-19(23-11-5-7-14-6-1-4-10-18(14)23)22-21-13-15-12-20-17-9-3-2-8-16(15)17/h1-4,6,8-10,12-13,20H,5,7,11H2,(H,22,24)/b21-13- |
| InChIKey | XGGVQWWOYFLZIU-BKUYFWCQSA-N |
| XLogP | 3.83 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|