C19H14Cl2N2O2 — CID 135796492
2-(2,6-dichlorophenyl)-2-[6-(2-hydroxyphenyl)-2-pyridinyl]acetamide (PubChem CID 135796492) has the molecular formula C19H14Cl2N2O2 and a molecular weight of 373.24 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-2-[6-(2-hydroxyphenyl)-2-pyridinyl]acetamide.
| Compound Name | 2-(2,6-dichlorophenyl)-2-[6-(2-hydroxyphenyl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 135796492 |
| Molecular Formula | C19H14Cl2N2O2 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-2-[6-(2-hydroxyphenyl)-2-pyridinyl]acetamide |
| SMILES | NC(=O)C(c1cccc(-c2ccccc2O)n1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H14Cl2N2O2/c20-12-6-3-7-13(21)17(12)18(19(22)25)15-9-4-8-14(23-15)11-5-1-2-10-16(11)24/h1-10,18,24H,(H2,22,25) |
| InChIKey | ZVABDVUIGWRTGZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |