C18H13Cl2N3OS — CID 7057222
(2R)-2-(2,6-dichlorophenyl)-2-(6-phenylsulfanylpyridazin-3-yl)acetamide (PubChem CID 7057222) has the molecular formula C18H13Cl2N3OS and a molecular weight of 390.30 g/mol. Its IUPAC name is (2R)-2-(2,6-dichlorophenyl)-2-(6-phenylsulfanylpyridazin-3-yl)acetamide.
| Compound Name | (2R)-2-(2,6-dichlorophenyl)-2-(6-phenylsulfanylpyridazin-3-yl)acetamide |
|---|---|
| PubChem CID | 7057222 |
| Molecular Formula | C18H13Cl2N3OS |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | (2R)-2-(2,6-dichlorophenyl)-2-(6-phenylsulfanylpyridazin-3-yl)acetamide |
| SMILES | NC(=O)[C@@H](c1ccc(Sc2ccccc2)nn1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H13Cl2N3OS/c19-12-7-4-8-13(20)16(12)17(18(21)24)14-9-10-15(23-22-14)25-11-5-2-1-3-6-11/h1-10,17H,(H2,21,24)/t17-/m0/s1 |
| InChIKey | KNYQYXSUQUVOAS-KRWDZBQOSA-N |
| XLogP | 4.55 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |