C20H14ClFN2O2 — CID 21354124
2-(2-chloro-6-fluorophenyl)-2-[6-(2-formylphenyl)-2-pyridinyl]acetamide (PubChem CID 21354124) has the molecular formula C20H14ClFN2O2 and a molecular weight of 368.80 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-2-[6-(2-formylphenyl)-2-pyridinyl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-2-[6-(2-formylphenyl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 21354124 |
| Molecular Formula | C20H14ClFN2O2 |
| Molecular Weight | 368.80 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-2-[6-(2-formylphenyl)-2-pyridinyl]acetamide |
| SMILES | NC(=O)C(c1cccc(-c2ccccc2C=O)n1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C20H14ClFN2O2/c21-14-7-3-8-15(22)18(14)19(20(23)26)17-10-4-9-16(24-17)13-6-2-1-5-12(13)11-25/h1-11,19H,(H2,23,26) |
| InChIKey | NYBOHFSCNHPCOS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.80 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|