C18H18N4O3S — CID 135796883
(2E,6R)-N-(3,4-dimethylphenyl)-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 135796883) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is (2E,6R)-N-(3,4-dimethylphenyl)-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (2E,6R)-N-(3,4-dimethylphenyl)-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 135796883 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (2E,6R)-N-(3,4-dimethylphenyl)-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2CC(=O)N/C(=N\N=C/c3ccco3)S2)cc1C |
| InChI | InChI=1S/C18H18N4O3S/c1-11-5-6-13(8-12(11)2)20-17(24)15-9-16(23)21-18(26-15)22-19-10-14-4-3-7-25-14/h3-8,10,15H,9H2,1-2H3,(H,20,24)(H,21,22,23)/b19-10-/t15-/m1/s1 |
| InChIKey | SMESDSSDEALFHS-SMLKNPDNSA-N |
| XLogP | 2.85 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|