C13H18N2O2 — CID 135799294
N-[(E)-1-(4-hydroxyphenyl)ethylideneamino]-3-methylbutanamide (PubChem CID 135799294) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is N-[(E)-1-(4-hydroxyphenyl)ethylideneamino]-3-methylbutanamide.
| Compound Name | N-[(E)-1-(4-hydroxyphenyl)ethylideneamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 135799294 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N-[(E)-1-(4-hydroxyphenyl)ethylideneamino]-3-methylbutanamide |
| SMILES | C/C(=N\NC(=O)CC(C)C)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H18N2O2/c1-9(2)8-13(17)15-14-10(3)11-4-6-12(16)7-5-11/h4-7,9,16H,8H2,1-3H3,(H,15,17)/b14-10+ |
| InChIKey | HLUMSPXHVVCKNY-GXDHUFHOSA-N |
| XLogP | 2.28 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|