C17H16N4O2S3 — CID 135799823
5-[(5E)-5-[amino(hydroxy)methylidene]-4-imino-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 135799823) has the molecular formula C17H16N4O2S3 and a molecular weight of 404.54 g/mol. Its IUPAC name is 5-[(5E)-5-[amino(hydroxy)methylidene]-4-imino-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(5E)-5-[amino(hydroxy)methylidene]-4-imino-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135799823 |
| Molecular Formula | C17H16N4O2S3 |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 5-[(5E)-5-[amino(hydroxy)methylidene]-4-imino-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | [H]/N=c1\c(=C(\N)O)sc(=C2SC(=S)N(c3ccc(C)cc3)C2=O)n1CC=C |
| InChI | InChI=1S/C17H16N4O2S3/c1-3-8-20-13(18)11(14(19)22)25-16(20)12-15(23)21(17(24)26-12)10-6-4-9(2)5-7-10/h3-7,18,22H,1,8,19H2,2H3/b14-11+,16-12?,18-13+ |
| InChIKey | MVXYHERBYQGCBS-TYXYVUIRSA-N |
| XLogP | 1.28 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|