C13H12N6O2S — CID 135800525
N-methyl-5-[1-(4-methylphenyl)-5-oxo-2H-triazol-4-yl]thiadiazole-4-carboxamide (PubChem CID 135800525) has the molecular formula C13H12N6O2S and a molecular weight of 316.35 g/mol. Its IUPAC name is N-methyl-5-[1-(4-methylphenyl)-5-oxo-2H-triazol-4-yl]thiadiazole-4-carboxamide.
| Compound Name | N-methyl-5-[1-(4-methylphenyl)-5-oxo-2H-triazol-4-yl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 135800525 |
| Molecular Formula | C13H12N6O2S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N-methyl-5-[1-(4-methylphenyl)-5-oxo-2H-triazol-4-yl]thiadiazole-4-carboxamide |
| SMILES | CNC(=O)c1nnsc1-c1n[nH]n(-c2ccc(C)cc2)c1=O |
| InChI | InChI=1S/C13H12N6O2S/c1-7-3-5-8(6-4-7)19-13(21)10(15-17-19)11-9(12(20)14-2)16-18-22-11/h3-6,17H,1-2H3,(H,14,20) |
| InChIKey | WYELQZWEEWKABG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |